C28H26O8S3 — CID 67163889
2-[4-[2-[2-[4-(2-hydroxyphenyl)sulfonylphenoxy]ethylsulfanyl]ethoxy]phenyl]sulfonylphenol (PubChem CID 67163889) has the molecular formula C28H26O8S3 and a molecular weight of 586.71 g/mol. Its IUPAC name is 2-[4-[2-[2-[4-(2-hydroxyphenyl)sulfonylphenoxy]ethylsulfanyl]ethoxy]phenyl]sulfonylphenol.
| Compound Name | 2-[4-[2-[2-[4-(2-hydroxyphenyl)sulfonylphenoxy]ethylsulfanyl]ethoxy]phenyl]sulfonylphenol |
|---|---|
| PubChem CID | 67163889 |
| Molecular Formula | C28H26O8S3 |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | 2-[4-[2-[2-[4-(2-hydroxyphenyl)sulfonylphenoxy]ethylsulfanyl]ethoxy]phenyl]sulfonylphenol |
| SMILES | O=S(=O)(c1ccc(OCCSCCOc2ccc(S(=O)(=O)c3ccccc3O)cc2)cc1)c1ccccc1O |
| InChI | InChI=1S/C28H26O8S3/c29-25-5-1-3-7-27(25)38(31,32)23-13-9-21(10-14-23)35-17-19-37-20-18-36-22-11-15-24(16-12-22)39(33,34)28-8-4-2-6-26(28)30/h1-16,29-30H,17-20H2 |
| InChIKey | DUYXMZMYRAMREJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|