C16H23ClN2O3 — CID 119426453
4-(4-methoxyphenyl)-4-oxo-N-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119426453) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-4-oxo-N-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | 4-(4-methoxyphenyl)-4-oxo-N-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119426453 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-4-oxo-N-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | COc1ccc(C(=O)CCC(=O)NC2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C16H22N2O3.ClH/c1-21-14-6-4-12(5-7-14)15(19)8-9-16(20)18-13-3-2-10-17-11-13;/h4-7,13,17H,2-3,8-11H2,1H3,(H,18,20);1H |
| InChIKey | CACCZOMNISWFEA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |