C16H21NO4S — CID 51240360
N-(1,1-dioxothiolan-3-yl)-4-(4-ethylphenyl)-4-oxobutanamide (PubChem CID 51240360) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(4-ethylphenyl)-4-oxobutanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(4-ethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 51240360 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(4-ethylphenyl)-4-oxobutanamide |
| SMILES | CCc1ccc(C(=O)CCC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H21NO4S/c1-2-12-3-5-13(6-4-12)15(18)7-8-16(19)17-14-9-10-22(20,21)11-14/h3-6,14H,2,7-11H2,1H3,(H,17,19) |
| InChIKey | RYOKIBWJPXVQND-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |