C18H25NO4S — CID 110297964
4-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)-4-oxobutanamide (PubChem CID 110297964) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)-4-oxobutanamide.
| Compound Name | 4-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 110297964 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-(4-tert-butylphenyl)-N-(1,1-dioxothiolan-3-yl)-4-oxobutanamide |
| SMILES | CC(C)(C)c1ccc(C(=O)CCC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C18H25NO4S/c1-18(2,3)14-6-4-13(5-7-14)16(20)8-9-17(21)19-15-10-11-24(22,23)12-15/h4-7,15H,8-12H2,1-3H3,(H,19,21) |
| InChIKey | SUTLZJREJCDACM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |