C17H23NO4S — CID 167799380
2-(4-tert-butylphenyl)-N-(1,1-dioxothian-4-yl)-2-oxoacetamide (PubChem CID 167799380) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-(1,1-dioxothian-4-yl)-2-oxoacetamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-(1,1-dioxothian-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 167799380 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-(1,1-dioxothian-4-yl)-2-oxoacetamide |
| SMILES | CC(C)(C)c1ccc(C(=O)C(=O)NC2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C17H23NO4S/c1-17(2,3)13-6-4-12(5-7-13)15(19)16(20)18-14-8-10-23(21,22)11-9-14/h4-7,14H,8-11H2,1-3H3,(H,18,20) |
| InChIKey | DTMGVPGZPNMREQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|