C46H52O4 — CID 15471929
2,3-bis(4-tert-butylbenzoyl)-1,4-bis(4-tert-butylphenyl)but-2-ene-1,4-dione (PubChem CID 15471929) has the molecular formula C46H52O4 and a molecular weight of 668.92 g/mol. Its IUPAC name is 2,3-bis(4-tert-butylbenzoyl)-1,4-bis(4-tert-butylphenyl)but-2-ene-1,4-dione.
| Compound Name | 2,3-bis(4-tert-butylbenzoyl)-1,4-bis(4-tert-butylphenyl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 15471929 |
| Molecular Formula | C46H52O4 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.39 |
| IUPAC Name | 2,3-bis(4-tert-butylbenzoyl)-1,4-bis(4-tert-butylphenyl)but-2-ene-1,4-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)C(C(=O)c2ccc(C(C)(C)C)cc2)=C(C(=O)c2ccc(C(C)(C)C)cc2)C(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C46H52O4/c1-43(2,3)33-21-13-29(14-22-33)39(47)37(40(48)30-15-23-34(24-16-30)44(4,5)6)38(41(49)31-17-25-35(26-18-31)45(7,8)9)42(50)32-19-27-36(28-20-32)46(10,11)12/h13-28H,1-12H3 |
| InChIKey | VBNWARHJLIPQNA-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|