About magnesium 4-tert-butylbenzoate
magnesium 4-tert-butylbenzoate (PubChem CID 21117899) has the molecular formula C11H13MgO2+
and a molecular weight of 201.53 g/mol. Its IUPAC name is magnesium 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | magnesium 4-tert-butylbenzoate |
| PubChem CID | 21117899 |
| Molecular Formula | C11H13MgO2+ |
| Molecular Weight | 201.53 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | magnesium 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)[O-])cc1.[Mg+2] |
| InChI | InChI=1S/C11H14O2.Mg/c1-11(2,3)9-6-4-8(5-7-9)10(12)13;/h4-7H,1-3H3,(H,12,13);/q;+2/p-1 |
| InChIKey | ZMZXWEVWHVXRPG-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze magnesium 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium 4-tert-butylbenzoate?
The IUPAC name of magnesium 4-tert-butylbenzoate (CID 21117899) is magnesium 4-tert-butylbenzoate.
What is the SMILES notation for magnesium 4-tert-butylbenzoate?
The canonical SMILES for magnesium 4-tert-butylbenzoate is CC(C)(C)c1ccc(C(=O)[O-])cc1.[Mg+2].
What is the InChIKey of magnesium 4-tert-butylbenzoate?
The InChIKey is ZMZXWEVWHVXRPG-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H14O2.Mg/c1-11(2,3)9-6-4-8(5-7-9)10(12)13;/h4-7H,1-3H3,(H,12,13);/q;+2/p-1.
What are the key properties of magnesium 4-tert-butylbenzoate?
magnesium 4-tert-butylbenzoate has a molecular weight of 201.53 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium 4-tert-butylbenzoate is sourced from PubChem (CID 21117899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).