C19H20MgO4 — CID 139776213
magnesium;4-tert-butylbenzoate;2-methylbenzoate (PubChem CID 139776213) has the molecular formula C19H20MgO4 and a molecular weight of 336.67 g/mol. Its IUPAC name is magnesium;4-tert-butylbenzoate;2-methylbenzoate.
| Compound Name | magnesium;4-tert-butylbenzoate;2-methylbenzoate |
|---|---|
| PubChem CID | 139776213 |
| Molecular Formula | C19H20MgO4 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | magnesium;4-tert-butylbenzoate;2-methylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)[O-])cc1.Cc1ccccc1C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C11H14O2.C8H8O2.Mg/c1-11(2,3)9-6-4-8(5-7-9)10(12)13;1-6-4-2-3-5-7(6)8(9)10;/h4-7H,1-3H3,(H,12,13);2-5H,1H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | LGNJGMJKDPHRFU-UHFFFAOYSA-L |
| XLogP | 1.33 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |