About 3,5-ditert-butylbenzoate;ethane;benzoate
3,5-ditert-butylbenzoate;ethane;benzoate (PubChem CID 91337173) has the molecular formula C24H32O4-2
and a molecular weight of 384.52 g/mol. Its IUPAC name is 3,5-ditert-butylbenzoate;ethane;benzoate.
Molecular Properties
| Compound Name | 3,5-ditert-butylbenzoate;ethane;benzoate |
| PubChem CID | 91337173 |
| Molecular Formula | C24H32O4-2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 3,5-ditert-butylbenzoate;ethane;benzoate |
| SMILES | CC.CC(C)(C)c1cc(C(=O)[O-])cc(C(C)(C)C)c1.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C15H22O2.C7H6O2.C2H6/c1-14(2,3)11-7-10(13(16)17)8-12(9-11)15(4,5)6;8-7(9)6-4-2-1-3-5-6;1-2/h7-9H,1-6H3,(H,16,17);1-5H,(H,8,9);1-2H3/p-2 |
| InChIKey | YIBYCBUUEKJDPK-UHFFFAOYSA-L |
| XLogP | 3.72 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-ditert-butylbenzoate;ethane;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butylbenzoate;ethane;benzoate?
The IUPAC name of 3,5-ditert-butylbenzoate;ethane;benzoate (CID 91337173) is 3,5-ditert-butylbenzoate;ethane;benzoate.
What is the SMILES notation for 3,5-ditert-butylbenzoate;ethane;benzoate?
The canonical SMILES for 3,5-ditert-butylbenzoate;ethane;benzoate is CC.CC(C)(C)c1cc(C(=O)[O-])cc(C(C)(C)C)c1.O=C([O-])c1ccccc1.
What is the InChIKey of 3,5-ditert-butylbenzoate;ethane;benzoate?
The InChIKey is YIBYCBUUEKJDPK-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H22O2.C7H6O2.C2H6/c1-14(2,3)11-7-10(13(16)17)8-12(9-11)15(4,5)6;8-7(9)6-4-2-1-3-5-6;1-2/h7-9H,1-6H3,(H,16,17);1-5H,(H,8,9);1-2H3/p-2.
What are the key properties of 3,5-ditert-butylbenzoate;ethane;benzoate?
3,5-ditert-butylbenzoate;ethane;benzoate has a molecular weight of 384.52 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butylbenzoate;ethane;benzoate is sourced from PubChem (CID 91337173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).