About magnesium;4-tert-butylbenzoate;hydroxide
magnesium;4-tert-butylbenzoate;hydroxide (PubChem CID 139776214) has the molecular formula C11H14MgO3
and a molecular weight of 218.53 g/mol. Its IUPAC name is magnesium;4-tert-butylbenzoate;hydroxide.
Molecular Properties
| Compound Name | magnesium;4-tert-butylbenzoate;hydroxide |
| PubChem CID | 139776214 |
| Molecular Formula | C11H14MgO3 |
| Molecular Weight | 218.53 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | magnesium;4-tert-butylbenzoate;hydroxide |
| SMILES | CC(C)(C)c1ccc(C(=O)[O-])cc1.[Mg+2].[OH-] |
| InChI | InChI=1S/C11H14O2.Mg.H2O/c1-11(2,3)9-6-4-8(5-7-9)10(12)13;;/h4-7H,1-3H3,(H,12,13);;1H2/q;+2;/p-2 |
| InChIKey | GPTKFBPQYLMYEB-UHFFFAOYSA-L |
| XLogP | 0.79 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.53 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze magnesium;4-tert-butylbenzoate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;4-tert-butylbenzoate;hydroxide?
The IUPAC name of magnesium;4-tert-butylbenzoate;hydroxide (CID 139776214) is magnesium;4-tert-butylbenzoate;hydroxide.
What is the SMILES notation for magnesium;4-tert-butylbenzoate;hydroxide?
The canonical SMILES for magnesium;4-tert-butylbenzoate;hydroxide is CC(C)(C)c1ccc(C(=O)[O-])cc1.[Mg+2].[OH-].
What is the InChIKey of magnesium;4-tert-butylbenzoate;hydroxide?
The InChIKey is GPTKFBPQYLMYEB-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H14O2.Mg.H2O/c1-11(2,3)9-6-4-8(5-7-9)10(12)13;;/h4-7H,1-3H3,(H,12,13);;1H2/q;+2;/p-2.
What are the key properties of magnesium;4-tert-butylbenzoate;hydroxide?
magnesium;4-tert-butylbenzoate;hydroxide has a molecular weight of 218.53 g/mol, XLogP of 0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;4-tert-butylbenzoate;hydroxide is sourced from PubChem (CID 139776214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).