C38H43F3O2S — CID 161087334
4-(trifluoromethyl)benzoate;tris(4-tert-butylphenyl)sulfanium (PubChem CID 161087334) has the molecular formula C38H43F3O2S and a molecular weight of 620.82 g/mol. Its IUPAC name is 4-(trifluoromethyl)benzoate;tris(4-tert-butylphenyl)sulfanium.
| Compound Name | 4-(trifluoromethyl)benzoate;tris(4-tert-butylphenyl)sulfanium |
|---|---|
| PubChem CID | 161087334 |
| Molecular Formula | C38H43F3O2S |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 4-(trifluoromethyl)benzoate;tris(4-tert-butylphenyl)sulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.O=C([O-])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H39S.C8H5F3O2/c1-28(2,3)22-10-16-25(17-11-22)31(26-18-12-23(13-19-26)29(4,5)6)27-20-14-24(15-21-27)30(7,8)9;9-8(10,11)6-3-1-5(2-4-6)7(12)13/h10-21H,1-9H3;1-4H,(H,12,13)/q+1;/p-1 |
| InChIKey | UGRVPZIFCKDGNP-UHFFFAOYSA-M |
| XLogP | 9.74 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|