C24H25F2O5S2+ — CID 157480954
(4-tert-butylphenyl)-diphenylsulfanium;2,2-difluoro-2-sulfoacetic acid (PubChem CID 157480954) has the molecular formula C24H25F2O5S2+ and a molecular weight of 495.59 g/mol. Its IUPAC name is (4-tert-butylphenyl)-diphenylsulfanium;2,2-difluoro-2-sulfoacetic acid.
| Compound Name | (4-tert-butylphenyl)-diphenylsulfanium;2,2-difluoro-2-sulfoacetic acid |
|---|---|
| PubChem CID | 157480954 |
| Molecular Formula | C24H25F2O5S2+ |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (4-tert-butylphenyl)-diphenylsulfanium;2,2-difluoro-2-sulfoacetic acid |
| SMILES | CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C(O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C22H23S.C2H2F2O5S/c1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;3-2(4,1(5)6)10(7,8)9/h4-17H,1-3H3;(H,5,6)(H,7,8,9)/q+1; |
| InChIKey | BWDOQNYGSJNIMR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|