C25H27F2O5S2+ — CID 87123789
(4-tert-butylphenyl)-diphenylsulfanium;methoxycarbonyl difluoromethanesulfonate (PubChem CID 87123789) has the molecular formula C25H27F2O5S2+ and a molecular weight of 509.62 g/mol. Its IUPAC name is (4-tert-butylphenyl)-diphenylsulfanium;methoxycarbonyl difluoromethanesulfonate.
| Compound Name | (4-tert-butylphenyl)-diphenylsulfanium;methoxycarbonyl difluoromethanesulfonate |
|---|---|
| PubChem CID | 87123789 |
| Molecular Formula | C25H27F2O5S2+ |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | (4-tert-butylphenyl)-diphenylsulfanium;methoxycarbonyl difluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.COC(=O)OS(=O)(=O)C(F)F |
| InChI | InChI=1S/C22H23S.C3H4F2O5S/c1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;1-9-3(6)10-11(7,8)2(4)5/h4-17H,1-3H3;2H,1H3/q+1; |
| InChIKey | MANWIDPPPNYZNT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|