C68H78O2S2+2 — CID 161258227
bis(4-tert-butylphenyl)-(4-phenoxyphenyl)sulfanium;[4-(4-tert-butylphenoxy)phenyl]-bis(4-tert-butylphenyl)sulfanium (PubChem CID 161258227) has the molecular formula C68H78O2S2+2 and a molecular weight of 991.50 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-(4-phenoxyphenyl)sulfanium;[4-(4-tert-butylphenoxy)phenyl]-bis(4-tert-butylphenyl)sulfanium.
| Compound Name | bis(4-tert-butylphenyl)-(4-phenoxyphenyl)sulfanium;[4-(4-tert-butylphenoxy)phenyl]-bis(4-tert-butylphenyl)sulfanium |
|---|---|
| PubChem CID | 161258227 |
| Molecular Formula | C68H78O2S2+2 |
| Molecular Weight | 991.50 g/mol |
| Exact Mass | 990.54 |
| IUPAC Name | bis(4-tert-butylphenyl)-(4-phenoxyphenyl)sulfanium;[4-(4-tert-butylphenoxy)phenyl]-bis(4-tert-butylphenyl)sulfanium |
| SMILES | CC(C)(C)c1ccc(Oc2ccc([S+](c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)cc2)cc1.CC(C)(C)c1ccc([S+](c2ccc(Oc3ccccc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H43OS.C32H35OS/c1-34(2,3)26-10-16-29(17-11-26)37-30-18-24-33(25-19-30)38(31-20-12-27(13-21-31)35(4,5)6)32-22-14-28(15-23-32)36(7,8)9;1-31(2,3)24-12-18-28(19-13-24)34(29-20-14-25(15-21-29)32(4,5)6)30-22-16-27(17-23-30)33-26-10-8-7-9-11-26/h10-25H,1-9H3;7-23H,1-6H3/q2*+1 |
| InChIKey | VCFDZURERWQMHE-UHFFFAOYSA-N |
| XLogP | 19.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.50 |
| LogP ≤ 5 | 19.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|