About bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium
bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium (PubChem CID 87387831) has the molecular formula C40H47IS+2
and a molecular weight of 686.79 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium.
Molecular Properties
| Compound Name | bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium |
| PubChem CID | 87387831 |
| Molecular Formula | C40H47IS+2 |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 686.24 |
| IUPAC Name | bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium |
| SMILES | CC.CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26I.C18H15S.C2H6/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2/h7-14H,1-6H3;1-15H;1-2H3/q2*+1; |
| InChIKey | BROXFMOQZZJMDE-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium?
The IUPAC name of bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium (CID 87387831) is bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium.
What is the SMILES notation for bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium?
The canonical SMILES for bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium is CC.CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium?
The InChIKey is BROXFMOQZZJMDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26I.C18H15S.C2H6/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2/h7-14H,1-6H3;1-15H;1-2H3/q2*+1;.
What are the key properties of bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium?
bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium has a molecular weight of 686.79 g/mol, XLogP of 8.22, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-tert-butylphenyl)iodanium;ethane;triphenylsulfanium is sourced from PubChem (CID 87387831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).