About diphenyliodanium;ethane;methane
diphenyliodanium;ethane;methane (PubChem CID 159636739) has the molecular formula C21H38I+
and a molecular weight of 417.44 g/mol. Its IUPAC name is diphenyliodanium;ethane;methane.
Molecular Properties
| Compound Name | diphenyliodanium;ethane;methane |
| PubChem CID | 159636739 |
| Molecular Formula | C21H38I+ |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | diphenyliodanium;ethane;methane |
| SMILES | C.CC.CC.CC.CC.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.4C2H6.CH4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;4*1-2;/h1-10H;4*1-2H3;1H4/q+1;;;;; |
| InChIKey | MPVNFHTXWZQKBL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diphenyliodanium;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyliodanium;ethane;methane?
The IUPAC name of diphenyliodanium;ethane;methane (CID 159636739) is diphenyliodanium;ethane;methane.
What is the SMILES notation for diphenyliodanium;ethane;methane?
The canonical SMILES for diphenyliodanium;ethane;methane is C.CC.CC.CC.CC.c1ccc([I+]c2ccccc2)cc1.
What is the InChIKey of diphenyliodanium;ethane;methane?
The InChIKey is MPVNFHTXWZQKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10I.4C2H6.CH4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;4*1-2;/h1-10H;4*1-2H3;1H4/q+1;;;;;.
What are the key properties of diphenyliodanium;ethane;methane?
diphenyliodanium;ethane;methane has a molecular weight of 417.44 g/mol, XLogP of 4.56, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyliodanium;ethane;methane is sourced from PubChem (CID 159636739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).