About diphenyliodanium;hydroiodide
diphenyliodanium;hydroiodide (PubChem CID 54604341) has the molecular formula C12H11I2+
and a molecular weight of 409.03 g/mol. Its IUPAC name is diphenyliodanium;hydroiodide.
Molecular Properties
| Compound Name | diphenyliodanium;hydroiodide |
| PubChem CID | 54604341 |
| Molecular Formula | C12H11I2+ |
| Molecular Weight | 409.03 g/mol |
| Exact Mass | 408.89 |
| IUPAC Name | diphenyliodanium;hydroiodide |
| SMILES | I.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.HI/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;1H/q+1; |
| InChIKey | WQIRVUAXANLUPO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.03 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diphenyliodanium;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyliodanium;hydroiodide?
The IUPAC name of diphenyliodanium;hydroiodide (CID 54604341) is diphenyliodanium;hydroiodide.
What is the SMILES notation for diphenyliodanium;hydroiodide?
The canonical SMILES for diphenyliodanium;hydroiodide is I.c1ccc([I+]c2ccccc2)cc1.
What is the InChIKey of diphenyliodanium;hydroiodide?
The InChIKey is WQIRVUAXANLUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10I.HI/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;1H/q+1;.
What are the key properties of diphenyliodanium;hydroiodide?
diphenyliodanium;hydroiodide has a molecular weight of 409.03 g/mol, XLogP of 0.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyliodanium;hydroiodide is sourced from PubChem (CID 54604341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).