C40H52I2+2 — CID 157112729
(4-tert-butylphenyl)-phenyliodanium;phenyl-(2,4,6-tritert-butylphenyl)iodanium (PubChem CID 157112729) has the molecular formula C40H52I2+2 and a molecular weight of 786.66 g/mol. Its IUPAC name is (4-tert-butylphenyl)-phenyliodanium;phenyl-(2,4,6-tritert-butylphenyl)iodanium.
| Compound Name | (4-tert-butylphenyl)-phenyliodanium;phenyl-(2,4,6-tritert-butylphenyl)iodanium |
|---|---|
| PubChem CID | 157112729 |
| Molecular Formula | C40H52I2+2 |
| Molecular Weight | 786.66 g/mol |
| Exact Mass | 786.21 |
| IUPAC Name | (4-tert-butylphenyl)-phenyliodanium;phenyl-(2,4,6-tritert-butylphenyl)iodanium |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c([I+]c2ccccc2)c(C(C)(C)C)c1.CC(C)(C)c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C24H34I.C16H18I/c1-22(2,3)17-15-19(23(4,5)6)21(20(16-17)24(7,8)9)25-18-13-11-10-12-14-18;1-16(2,3)13-9-11-15(12-10-13)17-14-7-5-4-6-8-14/h10-16H,1-9H3;4-12H,1-3H3/q2*+1 |
| InChIKey | AHASHQXUEVYKLG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.66 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|