C28H32OS — CID 102022126
(2R,3R)-5,7-ditert-butyl-2,3-diphenyl-2,3-dihydro-1,4-benzoxathiine (PubChem CID 102022126) has the molecular formula C28H32OS and a molecular weight of 416.63 g/mol. Its IUPAC name is (2R,3R)-5,7-ditert-butyl-2,3-diphenyl-2,3-dihydro-1,4-benzoxathiine.
| Compound Name | (2R,3R)-5,7-ditert-butyl-2,3-diphenyl-2,3-dihydro-1,4-benzoxathiine |
|---|---|
| PubChem CID | 102022126 |
| Molecular Formula | C28H32OS |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2R,3R)-5,7-ditert-butyl-2,3-diphenyl-2,3-dihydro-1,4-benzoxathiine |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)S[C@H](c1ccccc1)[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C28H32OS/c1-27(2,3)21-17-22(28(4,5)6)26-23(18-21)29-24(19-13-9-7-10-14-19)25(30-26)20-15-11-8-12-16-20/h7-18,24-25H,1-6H3/t24-,25-/m1/s1 |
| InChIKey | ZAJCDHXUYMTNGT-JWQCQUIFSA-N |
| XLogP | 8.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |