C15H12OS2 — CID 24874214
(4S,5R)-4,5-diphenyl-1,3-oxathiolane-2-thione (PubChem CID 24874214) has the molecular formula C15H12OS2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (4S,5R)-4,5-diphenyl-1,3-oxathiolane-2-thione.
| Compound Name | (4S,5R)-4,5-diphenyl-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 24874214 |
| Molecular Formula | C15H12OS2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | (4S,5R)-4,5-diphenyl-1,3-oxathiolane-2-thione |
| SMILES | S=C1O[C@H](c2ccccc2)[C@H](c2ccccc2)S1 |
| InChI | InChI=1S/C15H12OS2/c17-15-16-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+/m1/s1 |
| InChIKey | LJZKSHZCISZUNF-KGLIPLIRSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|