C9H10S — CID 134929070
(2S,3R)-2-methyl-3-phenylthiirane (PubChem CID 134929070) has the molecular formula C9H10S and a molecular weight of 150.25 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3-phenylthiirane.
| Compound Name | (2S,3R)-2-methyl-3-phenylthiirane |
|---|---|
| PubChem CID | 134929070 |
| Molecular Formula | C9H10S |
| Molecular Weight | 150.25 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | (2S,3R)-2-methyl-3-phenylthiirane |
| SMILES | C[C@@H]1S[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C9H10S/c1-7-9(10-7)8-5-3-2-4-6-8/h2-7,9H,1H3/t7-,9-/m0/s1 |
| InChIKey | MJNJRNCGQFMUOC-CBAPKCEASA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|