C14H21N — CID 163219493
(6R)-1,2,6-trimethyl-3-phenylpiperidine (PubChem CID 163219493) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (6R)-1,2,6-trimethyl-3-phenylpiperidine.
| Compound Name | (6R)-1,2,6-trimethyl-3-phenylpiperidine |
|---|---|
| PubChem CID | 163219493 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (6R)-1,2,6-trimethyl-3-phenylpiperidine |
| SMILES | CC1C(c2ccccc2)CC[C@@H](C)N1C |
| InChI | InChI=1S/C14H21N/c1-11-9-10-14(12(2)15(11)3)13-7-5-4-6-8-13/h4-8,11-12,14H,9-10H2,1-3H3/t11-,12?,14?/m1/s1 |
| InChIKey | GTVNPSMFLPGMLS-LKSINWNRSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |