C18H20O — CID 71654456
(2R,3R,6S)-6-methyl-2,3-diphenyloxane (PubChem CID 71654456) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (2R,3R,6S)-6-methyl-2,3-diphenyloxane.
| Compound Name | (2R,3R,6S)-6-methyl-2,3-diphenyloxane |
|---|---|
| PubChem CID | 71654456 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (2R,3R,6S)-6-methyl-2,3-diphenyloxane |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C18H20O/c1-14-12-13-17(15-8-4-2-5-9-15)18(19-14)16-10-6-3-7-11-16/h2-11,14,17-18H,12-13H2,1H3/t14-,17+,18-/m0/s1 |
| InChIKey | MXXMTEJQMULMSN-QGTPRVQTSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |