C16H25N — CID 91090574
(3S,4R)-1-tert-butyl-3-methyl-4-phenylpiperidine (PubChem CID 91090574) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (3S,4R)-1-tert-butyl-3-methyl-4-phenylpiperidine.
| Compound Name | (3S,4R)-1-tert-butyl-3-methyl-4-phenylpiperidine |
|---|---|
| PubChem CID | 91090574 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (3S,4R)-1-tert-butyl-3-methyl-4-phenylpiperidine |
| SMILES | C[C@@H]1CN(C(C)(C)C)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H25N/c1-13-12-17(16(2,3)4)11-10-15(13)14-8-6-5-7-9-14/h5-9,13,15H,10-12H2,1-4H3/t13-,15-/m1/s1 |
| InChIKey | FLJYPAYACLJVMY-UKRRQHHQSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |