C16H23NO2 — CID 124778661
4-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]butanoic acid (PubChem CID 124778661) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]butanoic acid.
| Compound Name | 4-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 124778661 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 4-[(3S,4R)-3-methyl-4-phenylpiperidin-1-yl]butanoic acid |
| SMILES | C[C@@H]1CN(CCCC(=O)O)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-13-12-17(10-5-8-16(18)19)11-9-15(13)14-6-3-2-4-7-14/h2-4,6-7,13,15H,5,8-12H2,1H3,(H,18,19)/t13-,15-/m1/s1 |
| InChIKey | WGQMQPHCCOLJHT-UKRRQHHQSA-N |
| XLogP | 2.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |