C21H28ClN — CID 3030420
1-butyl-3,4-diphenylpiperidine;hydrochloride (PubChem CID 3030420) has the molecular formula C21H28ClN and a molecular weight of 329.92 g/mol. Its IUPAC name is 1-butyl-3,4-diphenylpiperidine;hydrochloride.
| Compound Name | 1-butyl-3,4-diphenylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 3030420 |
| Molecular Formula | C21H28ClN |
| Molecular Weight | 329.92 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-butyl-3,4-diphenylpiperidine;hydrochloride |
| SMILES | CCCCN1CCC(c2ccccc2)C(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C21H27N.ClH/c1-2-3-15-22-16-14-20(18-10-6-4-7-11-18)21(17-22)19-12-8-5-9-13-19;/h4-13,20-21H,2-3,14-17H2,1H3;1H |
| InChIKey | UXXJHMIXTBYWOJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |