C20H25N — CID 129373468
(3R,4R)-1-ethyl-3-(3-methylphenyl)-4-phenylpiperidine (PubChem CID 129373468) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is (3R,4R)-1-ethyl-3-(3-methylphenyl)-4-phenylpiperidine.
| Compound Name | (3R,4R)-1-ethyl-3-(3-methylphenyl)-4-phenylpiperidine |
|---|---|
| PubChem CID | 129373468 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (3R,4R)-1-ethyl-3-(3-methylphenyl)-4-phenylpiperidine |
| SMILES | CCN1CC[C@@H](c2ccccc2)[C@H](c2cccc(C)c2)C1 |
| InChI | InChI=1S/C20H25N/c1-3-21-13-12-19(17-9-5-4-6-10-17)20(15-21)18-11-7-8-16(2)14-18/h4-11,14,19-20H,3,12-13,15H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | QYTDPEDVPXCAKK-PMACEKPBSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |