C23H30FNO2S — CID 70364796
(3S,4R)-3-(benzenesulfonylmethyl)-4-(4-fluorophenyl)-1-pentylpiperidine (PubChem CID 70364796) has the molecular formula C23H30FNO2S and a molecular weight of 403.56 g/mol. Its IUPAC name is (3S,4R)-3-(benzenesulfonylmethyl)-4-(4-fluorophenyl)-1-pentylpiperidine.
| Compound Name | (3S,4R)-3-(benzenesulfonylmethyl)-4-(4-fluorophenyl)-1-pentylpiperidine |
|---|---|
| PubChem CID | 70364796 |
| Molecular Formula | C23H30FNO2S |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (3S,4R)-3-(benzenesulfonylmethyl)-4-(4-fluorophenyl)-1-pentylpiperidine |
| SMILES | CCCCCN1CC[C@@H](c2ccc(F)cc2)[C@H](CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C23H30FNO2S/c1-2-3-7-15-25-16-14-23(19-10-12-21(24)13-11-19)20(17-25)18-28(26,27)22-8-5-4-6-9-22/h4-6,8-13,20,23H,2-3,7,14-18H2,1H3/t20-,23-/m0/s1 |
| InChIKey | ACMRDCGOBKCPRT-REWPJTCUSA-N |
| XLogP | 4.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|