C26H40N2O — CID 174897850
benzene;3-[3-[(dimethylamino)methyl]-1-hexylpiperidin-4-yl]phenol (PubChem CID 174897850) has the molecular formula C26H40N2O and a molecular weight of 396.62 g/mol. Its IUPAC name is benzene;3-[3-[(dimethylamino)methyl]-1-hexylpiperidin-4-yl]phenol.
| Compound Name | benzene;3-[3-[(dimethylamino)methyl]-1-hexylpiperidin-4-yl]phenol |
|---|---|
| PubChem CID | 174897850 |
| Molecular Formula | C26H40N2O |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | benzene;3-[3-[(dimethylamino)methyl]-1-hexylpiperidin-4-yl]phenol |
| SMILES | CCCCCCN1CCC(c2cccc(O)c2)C(CN(C)C)C1.c1ccccc1 |
| InChI | InChI=1S/C20H34N2O.C6H6/c1-4-5-6-7-12-22-13-11-20(18(16-22)15-21(2)3)17-9-8-10-19(23)14-17;1-2-4-6-5-3-1/h8-10,14,18,20,23H,4-7,11-13,15-16H2,1-3H3;1-6H |
| InChIKey | JIVKPTZCJXPISZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|