C20H37NO2 — CID 142251041
3-[2-[(dimethylamino)methyl]cyclohexyl]phenol;methoxymethane;propane (PubChem CID 142251041) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is 3-[2-[(dimethylamino)methyl]cyclohexyl]phenol;methoxymethane;propane.
| Compound Name | 3-[2-[(dimethylamino)methyl]cyclohexyl]phenol;methoxymethane;propane |
|---|---|
| PubChem CID | 142251041 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | 3-[2-[(dimethylamino)methyl]cyclohexyl]phenol;methoxymethane;propane |
| SMILES | CCC.CN(C)CC1CCCCC1c1cccc(O)c1.COC |
| InChI | InChI=1S/C15H23NO.C3H8.C2H6O/c1-16(2)11-13-6-3-4-9-15(13)12-7-5-8-14(17)10-12;2*1-3-2/h5,7-8,10,13,15,17H,3-4,6,9,11H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | ISJZSHKLWZYXFU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |