C20H31NO3 — CID 22883940
[3-[(1R,2S)-2-[(dimethylamino)methyl]cyclohexyl]phenyl] 2-methylpropyl carbonate (PubChem CID 22883940) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [3-[(1R,2S)-2-[(dimethylamino)methyl]cyclohexyl]phenyl] 2-methylpropyl carbonate.
| Compound Name | [3-[(1R,2S)-2-[(dimethylamino)methyl]cyclohexyl]phenyl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 22883940 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [3-[(1R,2S)-2-[(dimethylamino)methyl]cyclohexyl]phenyl] 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)Oc1cccc([C@@H]2CCCC[C@@H]2CN(C)C)c1 |
| InChI | InChI=1S/C20H31NO3/c1-15(2)14-23-20(22)24-18-10-7-9-16(12-18)19-11-6-5-8-17(19)13-21(3)4/h7,9-10,12,15,17,19H,5-6,8,11,13-14H2,1-4H3/t17-,19+/m1/s1 |
| InChIKey | ASAQDHKNFGQZON-MJGOQNOKSA-N |
| XLogP | 4.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|