C16H29ClNO+ — CID 158588851
[2-(3-hydroxyphenyl)cyclohexyl]methyl-dimethylazanium;methane;hydrochloride (PubChem CID 158588851) has the molecular formula C16H29ClNO+ and a molecular weight of 286.87 g/mol. Its IUPAC name is [2-(3-hydroxyphenyl)cyclohexyl]methyl-dimethylazanium;methane;hydrochloride.
| Compound Name | [2-(3-hydroxyphenyl)cyclohexyl]methyl-dimethylazanium;methane;hydrochloride |
|---|---|
| PubChem CID | 158588851 |
| Molecular Formula | C16H29ClNO+ |
| Molecular Weight | 286.87 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [2-(3-hydroxyphenyl)cyclohexyl]methyl-dimethylazanium;methane;hydrochloride |
| SMILES | C.C[NH+](C)CC1CCCCC1c1cccc(O)c1.Cl |
| InChI | InChI=1S/C15H23NO.CH4.ClH/c1-16(2)11-13-6-3-4-9-15(13)12-7-5-8-14(17)10-12;;/h5,7-8,10,13,15,17H,3-4,6,9,11H2,1-2H3;1H4;1H/p+1 |
| InChIKey | JXZWXRCAWDALHV-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.87 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |