C10H13NO — CID 105432221
3-[(2R)-2-(aminomethyl)cyclopropyl]phenol (PubChem CID 105432221) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-[(2R)-2-(aminomethyl)cyclopropyl]phenol.
| Compound Name | 3-[(2R)-2-(aminomethyl)cyclopropyl]phenol |
|---|---|
| PubChem CID | 105432221 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-[(2R)-2-(aminomethyl)cyclopropyl]phenol |
| SMILES | NC[C@@H]1CC1c1cccc(O)c1 |
| InChI | InChI=1S/C10H13NO/c11-6-8-5-10(8)7-2-1-3-9(12)4-7/h1-4,8,10,12H,5-6,11H2/t8-,10?/m0/s1 |
| InChIKey | NZTVPKOZOOULAP-PEHGTWAWSA-N |
| XLogP | 1.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |