C17H22O — CID 132554060
3-[(1R,8S)-4-tricyclo[4.3.1.13,8]undecanyl]phenol (PubChem CID 132554060) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-[(1R,8S)-4-tricyclo[4.3.1.13,8]undecanyl]phenol.
| Compound Name | 3-[(1R,8S)-4-tricyclo[4.3.1.13,8]undecanyl]phenol |
|---|---|
| PubChem CID | 132554060 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 3-[(1R,8S)-4-tricyclo[4.3.1.13,8]undecanyl]phenol |
| SMILES | Oc1cccc(C2CC3C[C@@H]4CC2C[C@H](C3)C4)c1 |
| InChI | InChI=1S/C17H22O/c18-16-3-1-2-14(10-16)17-9-13-5-11-4-12(6-13)8-15(17)7-11/h1-3,10-13,15,17-18H,4-9H2/t11-,12+,13?,15?,17? |
| InChIKey | MSSTURCOZGDFDF-DYKCDNOASA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |