About magnesium;benzene-1,3-diol;oxygen(2-)
magnesium;benzene-1,3-diol;oxygen(2-) (PubChem CID 158172570) has the molecular formula C6H6MgO3
and a molecular weight of 150.42 g/mol. Its IUPAC name is magnesium;benzene-1,3-diol;oxygen(2-).
Molecular Properties
| Compound Name | magnesium;benzene-1,3-diol;oxygen(2-) |
| PubChem CID | 158172570 |
| Molecular Formula | C6H6MgO3 |
| Molecular Weight | 150.42 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | magnesium;benzene-1,3-diol;oxygen(2-) |
| SMILES | Oc1cccc(O)c1.[Mg+2].[O-2] |
| InChI | InChI=1S/C6H6O2.Mg.O/c7-5-2-1-3-6(8)4-5;;/h1-4,7-8H;;/q;+2;-2 |
| InChIKey | FXQBXDNOFKDYMK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze magnesium;benzene-1,3-diol;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;benzene-1,3-diol;oxygen(2-)?
The IUPAC name of magnesium;benzene-1,3-diol;oxygen(2-) (CID 158172570) is magnesium;benzene-1,3-diol;oxygen(2-).
What is the SMILES notation for magnesium;benzene-1,3-diol;oxygen(2-)?
The canonical SMILES for magnesium;benzene-1,3-diol;oxygen(2-) is Oc1cccc(O)c1.[Mg+2].[O-2].
What is the InChIKey of magnesium;benzene-1,3-diol;oxygen(2-)?
The InChIKey is FXQBXDNOFKDYMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.Mg.O/c7-5-2-1-3-6(8)4-5;;/h1-4,7-8H;;/q;+2;-2.
What are the key properties of magnesium;benzene-1,3-diol;oxygen(2-)?
magnesium;benzene-1,3-diol;oxygen(2-) has a molecular weight of 150.42 g/mol, XLogP of 0.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;benzene-1,3-diol;oxygen(2-) is sourced from PubChem (CID 158172570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).