benzene-1,3-diol;phosphoric acid

C6H9O6P — CID 66603395

IUPACbenzene-1,3-diol;phosphoric acid
SMILESO=P(O)(O)O.Oc1cccc(O)c1
InChIInChI=1S/C6H6O2.H3O4P/c7-5-2-1-3-6(8)4-5;1-5(2,3)4/h1-4,7-8H;(H3,1,2,3,4)
InChIKeyASDFHLVGJMRDTI-UHFFFAOYSA-N
MW208.11 g/mol
LogP0.17
Rot. Bonds

About benzene-1,3-diol;phosphoric acid

benzene-1,3-diol;phosphoric acid (PubChem CID 66603395) has the molecular formula C6H9O6P and a molecular weight of 208.11 g/mol. Its IUPAC name is benzene-1,3-diol;phosphoric acid.

Molecular Properties

Compound Namebenzene-1,3-diol;phosphoric acid
PubChem CID66603395
Molecular FormulaC6H9O6P
Molecular Weight208.11 g/mol
Exact Mass208.01
IUPAC Namebenzene-1,3-diol;phosphoric acid
SMILESO=P(O)(O)O.Oc1cccc(O)c1
InChIInChI=1S/C6H6O2.H3O4P/c7-5-2-1-3-6(8)4-5;1-5(2,3)4/h1-4,7-8H;(H3,1,2,3,4)
InChIKeyASDFHLVGJMRDTI-UHFFFAOYSA-N
XLogP0.17
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.11
LogP ≤ 50.17
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze benzene-1,3-diol;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzene-1,3-diol;phosphoric acid?
The IUPAC name of benzene-1,3-diol;phosphoric acid (CID 66603395) is benzene-1,3-diol;phosphoric acid.
What is the SMILES notation for benzene-1,3-diol;phosphoric acid?
The canonical SMILES for benzene-1,3-diol;phosphoric acid is O=P(O)(O)O.Oc1cccc(O)c1.
What is the InChIKey of benzene-1,3-diol;phosphoric acid?
The InChIKey is ASDFHLVGJMRDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.H3O4P/c7-5-2-1-3-6(8)4-5;1-5(2,3)4/h1-4,7-8H;(H3,1,2,3,4).
What are the key properties of benzene-1,3-diol;phosphoric acid?
benzene-1,3-diol;phosphoric acid has a molecular weight of 208.11 g/mol, XLogP of 0.17, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;phosphoric acid is sourced from PubChem (CID 66603395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).