C6H9O6P — CID 66603395
benzene-1,3-diol;phosphoric acid (PubChem CID 66603395) has the molecular formula C6H9O6P and a molecular weight of 208.11 g/mol. Its IUPAC name is benzene-1,3-diol;phosphoric acid.
| Compound Name | benzene-1,3-diol;phosphoric acid |
|---|---|
| PubChem CID | 66603395 |
| Molecular Formula | C6H9O6P |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | benzene-1,3-diol;phosphoric acid |
| SMILES | O=P(O)(O)O.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2.H3O4P/c7-5-2-1-3-6(8)4-5;1-5(2,3)4/h1-4,7-8H;(H3,1,2,3,4) |
| InChIKey | ASDFHLVGJMRDTI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|