C6H13O9P3 — CID 174927128
benzene-1,3-diol;phosphane;phosphono dihydrogen phosphate (PubChem CID 174927128) has the molecular formula C6H13O9P3 and a molecular weight of 322.08 g/mol. Its IUPAC name is benzene-1,3-diol;phosphane;phosphono dihydrogen phosphate.
| Compound Name | benzene-1,3-diol;phosphane;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 174927128 |
| Molecular Formula | C6H13O9P3 |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | benzene-1,3-diol;phosphane;phosphono dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)O.Oc1cccc(O)c1.P |
| InChI | InChI=1S/C6H6O2.H4O7P2.H3P/c7-5-2-1-3-6(8)4-5;1-8(2,3)7-9(4,5)6;/h1-4,7-8H;(H2,1,2,3)(H2,4,5,6);1H3 |
| InChIKey | ZIKMKQRCPYNVGP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|