C6H11O13P3 — CID 87864287
benzene-1,2,3-triol;diphosphono hydrogen phosphate (PubChem CID 87864287) has the molecular formula C6H11O13P3 and a molecular weight of 384.06 g/mol. Its IUPAC name is benzene-1,2,3-triol;diphosphono hydrogen phosphate.
| Compound Name | benzene-1,2,3-triol;diphosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87864287 |
| Molecular Formula | C6H11O13P3 |
| Molecular Weight | 384.06 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | benzene-1,2,3-triol;diphosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)O.Oc1cccc(O)c1O |
| InChI | InChI=1S/C6H6O3.H5O10P3/c7-4-2-1-3-5(8)6(4)9;1-11(2,3)9-13(7,8)10-12(4,5)6/h1-3,7-9H;(H,7,8)(H2,1,2,3)(H2,4,5,6) |
| InChIKey | UAGNXJHNKSQBQM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 231.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.06 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|