About tris(2,3-dihydroxyphenyl) phosphate
tris(2,3-dihydroxyphenyl) phosphate (PubChem CID 141021157) has the molecular formula C18H15O10P
and a molecular weight of 422.28 g/mol. Its IUPAC name is tris(2,3-dihydroxyphenyl) phosphate.
Molecular Properties
| Compound Name | tris(2,3-dihydroxyphenyl) phosphate |
| PubChem CID | 141021157 |
| Molecular Formula | C18H15O10P |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | tris(2,3-dihydroxyphenyl) phosphate |
| SMILES | O=P(Oc1cccc(O)c1O)(Oc1cccc(O)c1O)Oc1cccc(O)c1O |
| InChI | InChI=1S/C18H15O10P/c19-10-4-1-7-13(16(10)22)26-29(25,27-14-8-2-5-11(20)17(14)23)28-15-9-3-6-12(21)18(15)24/h1-9,19-24H |
| InChIKey | ZKBYYDKGUMVYPD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(2,3-dihydroxyphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2,3-dihydroxyphenyl) phosphate?
The IUPAC name of tris(2,3-dihydroxyphenyl) phosphate (CID 141021157) is tris(2,3-dihydroxyphenyl) phosphate.
What is the SMILES notation for tris(2,3-dihydroxyphenyl) phosphate?
The canonical SMILES for tris(2,3-dihydroxyphenyl) phosphate is O=P(Oc1cccc(O)c1O)(Oc1cccc(O)c1O)Oc1cccc(O)c1O.
What is the InChIKey of tris(2,3-dihydroxyphenyl) phosphate?
The InChIKey is ZKBYYDKGUMVYPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15O10P/c19-10-4-1-7-13(16(10)22)26-29(25,27-14-8-2-5-11(20)17(14)23)28-15-9-3-6-12(21)18(15)24/h1-9,19-24H.
What are the key properties of tris(2,3-dihydroxyphenyl) phosphate?
tris(2,3-dihydroxyphenyl) phosphate has a molecular weight of 422.28 g/mol, XLogP of 3.57, 6 rotatable bonds, 6 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2,3-dihydroxyphenyl) phosphate is sourced from PubChem (CID 141021157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).