C54H39O7P — CID 139835214
tris(4-hydroxy-2,3-diphenylphenyl) phosphate (PubChem CID 139835214) has the molecular formula C54H39O7P and a molecular weight of 830.87 g/mol. Its IUPAC name is tris(4-hydroxy-2,3-diphenylphenyl) phosphate.
| Compound Name | tris(4-hydroxy-2,3-diphenylphenyl) phosphate |
|---|---|
| PubChem CID | 139835214 |
| Molecular Formula | C54H39O7P |
| Molecular Weight | 830.87 g/mol |
| Exact Mass | 830.24 |
| IUPAC Name | tris(4-hydroxy-2,3-diphenylphenyl) phosphate |
| SMILES | O=P(Oc1ccc(O)c(-c2ccccc2)c1-c1ccccc1)(Oc1ccc(O)c(-c2ccccc2)c1-c1ccccc1)Oc1ccc(O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C54H39O7P/c55-43-31-34-46(52(40-25-13-4-14-26-40)49(43)37-19-7-1-8-20-37)59-62(58,60-47-35-32-44(56)50(38-21-9-2-10-22-38)53(47)41-27-15-5-16-28-41)61-48-36-33-45(57)51(39-23-11-3-12-24-39)54(48)42-29-17-6-18-30-42/h1-36,55-57H |
| InChIKey | VUULCEAVPIKOKZ-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.87 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|