C40H35O4P — CID 175192889
[4-(2-tert-butylphenyl)-2,3-diphenylphenyl] diphenyl phosphate (PubChem CID 175192889) has the molecular formula C40H35O4P and a molecular weight of 610.69 g/mol. Its IUPAC name is [4-(2-tert-butylphenyl)-2,3-diphenylphenyl] diphenyl phosphate.
| Compound Name | [4-(2-tert-butylphenyl)-2,3-diphenylphenyl] diphenyl phosphate |
|---|---|
| PubChem CID | 175192889 |
| Molecular Formula | C40H35O4P |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | [4-(2-tert-butylphenyl)-2,3-diphenylphenyl] diphenyl phosphate |
| SMILES | CC(C)(C)c1ccccc1-c1ccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C40H35O4P/c1-40(2,3)36-27-17-16-26-34(36)35-28-29-37(39(31-20-10-5-11-21-31)38(35)30-18-8-4-9-19-30)44-45(41,42-32-22-12-6-13-23-32)43-33-24-14-7-15-25-33/h4-29H,1-3H3 |
| InChIKey | TWXUIHDQBJRJRO-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|