C60H78O8P2 — CID 158310667
bis(2,4-ditert-butylphenyl) phenyl phosphate;(2,4-ditert-butylphenyl) diphenyl phosphate (PubChem CID 158310667) has the molecular formula C60H78O8P2 and a molecular weight of 989.22 g/mol. Its IUPAC name is bis(2,4-ditert-butylphenyl) phenyl phosphate;(2,4-ditert-butylphenyl) diphenyl phosphate.
| Compound Name | bis(2,4-ditert-butylphenyl) phenyl phosphate;(2,4-ditert-butylphenyl) diphenyl phosphate |
|---|---|
| PubChem CID | 158310667 |
| Molecular Formula | C60H78O8P2 |
| Molecular Weight | 989.22 g/mol |
| Exact Mass | 988.52 |
| IUPAC Name | bis(2,4-ditert-butylphenyl) phenyl phosphate;(2,4-ditert-butylphenyl) diphenyl phosphate |
| SMILES | CC(C)(C)c1ccc(OP(=O)(Oc2ccccc2)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1.CC(C)(C)c1ccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H47O4P.C26H31O4P/c1-31(2,3)24-18-20-29(27(22-24)33(7,8)9)37-39(35,36-26-16-14-13-15-17-26)38-30-21-19-25(32(4,5)6)23-28(30)34(10,11)12;1-25(2,3)20-17-18-24(23(19-20)26(4,5)6)30-31(27,28-21-13-9-7-10-14-21)29-22-15-11-8-12-16-22/h13-23H,1-12H3;7-19H,1-6H3 |
| InChIKey | GNQJHDQLISDSFO-UHFFFAOYSA-N |
| XLogP | 18.45 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.22 |
| LogP ≤ 5 | 18.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|