C63H51O4P — CID 87935037
tris(2,3-diphenyl-4-prop-1-en-2-ylphenyl) phosphate (PubChem CID 87935037) has the molecular formula C63H51O4P and a molecular weight of 903.07 g/mol. Its IUPAC name is tris(2,3-diphenyl-4-prop-1-en-2-ylphenyl) phosphate.
| Compound Name | tris(2,3-diphenyl-4-prop-1-en-2-ylphenyl) phosphate |
|---|---|
| PubChem CID | 87935037 |
| Molecular Formula | C63H51O4P |
| Molecular Weight | 903.07 g/mol |
| Exact Mass | 902.35 |
| IUPAC Name | tris(2,3-diphenyl-4-prop-1-en-2-ylphenyl) phosphate |
| SMILES | C=C(C)c1ccc(OP(=O)(Oc2ccc(C(=C)C)c(-c3ccccc3)c2-c2ccccc2)Oc2ccc(C(=C)C)c(-c3ccccc3)c2-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C63H51O4P/c1-43(2)52-37-40-55(61(49-31-19-10-20-32-49)58(52)46-25-13-7-14-26-46)65-68(64,66-56-41-38-53(44(3)4)59(47-27-15-8-16-28-47)62(56)50-33-21-11-22-34-50)67-57-42-39-54(45(5)6)60(48-29-17-9-18-30-48)63(57)51-35-23-12-24-36-51/h7-42H,1,3,5H2,2,4,6H3 |
| InChIKey | GEUYVPUZSZWTJM-UHFFFAOYSA-N |
| XLogP | 18.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.07 |
| LogP ≤ 5 | 18.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|