C21H21O4P — CID 150021932
(2,3-diphenyl-4-propan-2-ylphenyl) dihydrogen phosphate (PubChem CID 150021932) has the molecular formula C21H21O4P and a molecular weight of 368.37 g/mol. Its IUPAC name is (2,3-diphenyl-4-propan-2-ylphenyl) dihydrogen phosphate.
| Compound Name | (2,3-diphenyl-4-propan-2-ylphenyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 150021932 |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2,3-diphenyl-4-propan-2-ylphenyl) dihydrogen phosphate |
| SMILES | CC(C)c1ccc(OP(=O)(O)O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H21O4P/c1-15(2)18-13-14-19(25-26(22,23)24)21(17-11-7-4-8-12-17)20(18)16-9-5-3-6-10-16/h3-15H,1-2H3,(H2,22,23,24) |
| InChIKey | DFKWMSUAYJNYMS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|