C27H25O4P — CID 139777341
[3-(4-methylphenyl)-4-phenyl-2-(1-phenylethyl)phenyl] dihydrogen phosphate (PubChem CID 139777341) has the molecular formula C27H25O4P and a molecular weight of 444.47 g/mol. Its IUPAC name is [3-(4-methylphenyl)-4-phenyl-2-(1-phenylethyl)phenyl] dihydrogen phosphate.
| Compound Name | [3-(4-methylphenyl)-4-phenyl-2-(1-phenylethyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 139777341 |
| Molecular Formula | C27H25O4P |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [3-(4-methylphenyl)-4-phenyl-2-(1-phenylethyl)phenyl] dihydrogen phosphate |
| SMILES | Cc1ccc(-c2c(-c3ccccc3)ccc(OP(=O)(O)O)c2C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25O4P/c1-19-13-15-23(16-14-19)27-24(22-11-7-4-8-12-22)17-18-25(31-32(28,29)30)26(27)20(2)21-9-5-3-6-10-21/h3-18,20H,1-2H3,(H2,28,29,30) |
| InChIKey | LJDWOVYJZNFFPH-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|