C12H16O2 — CID 175029396
1,2-bis(prop-1-en-2-yl)benzene;hydrogen peroxide (PubChem CID 175029396) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 1,2-bis(prop-1-en-2-yl)benzene;hydrogen peroxide.
| Compound Name | 1,2-bis(prop-1-en-2-yl)benzene;hydrogen peroxide |
|---|---|
| PubChem CID | 175029396 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 1,2-bis(prop-1-en-2-yl)benzene;hydrogen peroxide |
| SMILES | C=C(C)c1ccccc1C(=C)C.OO |
| InChI | InChI=1S/C12H14.H2O2/c1-9(2)11-7-5-6-8-12(11)10(3)4;1-2/h5-8H,1,3H2,2,4H3;1-2H |
| InChIKey | OWSJVDUWJJNXHH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|