About lithium 2-prop-1-en-2-ylbenzoate
lithium 2-prop-1-en-2-ylbenzoate (PubChem CID 102161119) has the molecular formula C10H9LiO2
and a molecular weight of 168.12 g/mol. Its IUPAC name is lithium 2-prop-1-en-2-ylbenzoate.
Molecular Properties
| Compound Name | lithium 2-prop-1-en-2-ylbenzoate |
| PubChem CID | 102161119 |
| Molecular Formula | C10H9LiO2 |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | lithium 2-prop-1-en-2-ylbenzoate |
| SMILES | C=C(C)c1ccccc1C(=O)[O-].[Li+] |
| InChI | InChI=1S/C10H10O2.Li/c1-7(2)8-5-3-4-6-9(8)10(11)12;/h3-6H,1H2,2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | JMYTYZXQHLBRJX-UHFFFAOYSA-M |
| XLogP | -1.91 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium 2-prop-1-en-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-prop-1-en-2-ylbenzoate?
The IUPAC name of lithium 2-prop-1-en-2-ylbenzoate (CID 102161119) is lithium 2-prop-1-en-2-ylbenzoate.
What is the SMILES notation for lithium 2-prop-1-en-2-ylbenzoate?
The canonical SMILES for lithium 2-prop-1-en-2-ylbenzoate is C=C(C)c1ccccc1C(=O)[O-].[Li+].
What is the InChIKey of lithium 2-prop-1-en-2-ylbenzoate?
The InChIKey is JMYTYZXQHLBRJX-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10O2.Li/c1-7(2)8-5-3-4-6-9(8)10(11)12;/h3-6H,1H2,2H3,(H,11,12);/q;+1/p-1.
What are the key properties of lithium 2-prop-1-en-2-ylbenzoate?
lithium 2-prop-1-en-2-ylbenzoate has a molecular weight of 168.12 g/mol, XLogP of -1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-prop-1-en-2-ylbenzoate is sourced from PubChem (CID 102161119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).