About 1,2-bis(prop-1-en-2-yl)benzene;propane
1,2-bis(prop-1-en-2-yl)benzene;propane (PubChem CID 142274191) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 1,2-bis(prop-1-en-2-yl)benzene;propane.
Molecular Properties
| Compound Name | 1,2-bis(prop-1-en-2-yl)benzene;propane |
| PubChem CID | 142274191 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1,2-bis(prop-1-en-2-yl)benzene;propane |
| SMILES | C=C(C)c1ccccc1C(=C)C.CCC |
| InChI | InChI=1S/C12H14.C3H8/c1-9(2)11-7-5-6-8-12(11)10(3)4;1-3-2/h5-8H,1,3H2,2,4H3;3H2,1-2H3 |
| InChIKey | STDCKUMNVZHKMS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-bis(prop-1-en-2-yl)benzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(prop-1-en-2-yl)benzene;propane?
The IUPAC name of 1,2-bis(prop-1-en-2-yl)benzene;propane (CID 142274191) is 1,2-bis(prop-1-en-2-yl)benzene;propane.
What is the SMILES notation for 1,2-bis(prop-1-en-2-yl)benzene;propane?
The canonical SMILES for 1,2-bis(prop-1-en-2-yl)benzene;propane is C=C(C)c1ccccc1C(=C)C.CCC.
What is the InChIKey of 1,2-bis(prop-1-en-2-yl)benzene;propane?
The InChIKey is STDCKUMNVZHKMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.C3H8/c1-9(2)11-7-5-6-8-12(11)10(3)4;1-3-2/h5-8H,1,3H2,2,4H3;3H2,1-2H3.
What are the key properties of 1,2-bis(prop-1-en-2-yl)benzene;propane?
1,2-bis(prop-1-en-2-yl)benzene;propane has a molecular weight of 202.34 g/mol, XLogP of 5.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(prop-1-en-2-yl)benzene;propane is sourced from PubChem (CID 142274191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).