C12H14Li+ — CID 22717015
lithium 1,2-bis(prop-1-en-2-yl)benzene (PubChem CID 22717015) has the molecular formula C12H14Li+ and a molecular weight of 165.18 g/mol. Its IUPAC name is lithium 1,2-bis(prop-1-en-2-yl)benzene.
| Compound Name | lithium 1,2-bis(prop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 22717015 |
| Molecular Formula | C12H14Li+ |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | lithium 1,2-bis(prop-1-en-2-yl)benzene |
| SMILES | C=C(C)c1ccccc1C(=C)C.[Li+] |
| InChI | InChI=1S/C12H14.Li/c1-9(2)11-7-5-6-8-12(11)10(3)4;/h5-8H,1,3H2,2,4H3;/q;+1 |
| InChIKey | ZCVKONCLGBSSEQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |