About 1-iodopropane;2-prop-1-en-2-ylaniline
1-iodopropane;2-prop-1-en-2-ylaniline (PubChem CID 159191806) has the molecular formula C12H18IN
and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-iodopropane;2-prop-1-en-2-ylaniline.
Molecular Properties
| Compound Name | 1-iodopropane;2-prop-1-en-2-ylaniline |
| PubChem CID | 159191806 |
| Molecular Formula | C12H18IN |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-iodopropane;2-prop-1-en-2-ylaniline |
| SMILES | C=C(C)c1ccccc1N.CCCI |
| InChI | InChI=1S/C9H11N.C3H7I/c1-7(2)8-5-3-4-6-9(8)10;1-2-3-4/h3-6H,1,10H2,2H3;2-3H2,1H3 |
| InChIKey | KOEIAFRFBBGJHY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodopropane;2-prop-1-en-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodopropane;2-prop-1-en-2-ylaniline?
The IUPAC name of 1-iodopropane;2-prop-1-en-2-ylaniline (CID 159191806) is 1-iodopropane;2-prop-1-en-2-ylaniline.
What is the SMILES notation for 1-iodopropane;2-prop-1-en-2-ylaniline?
The canonical SMILES for 1-iodopropane;2-prop-1-en-2-ylaniline is C=C(C)c1ccccc1N.CCCI.
What is the InChIKey of 1-iodopropane;2-prop-1-en-2-ylaniline?
The InChIKey is KOEIAFRFBBGJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C3H7I/c1-7(2)8-5-3-4-6-9(8)10;1-2-3-4/h3-6H,1,10H2,2H3;2-3H2,1H3.
What are the key properties of 1-iodopropane;2-prop-1-en-2-ylaniline?
1-iodopropane;2-prop-1-en-2-ylaniline has a molecular weight of 303.19 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodopropane;2-prop-1-en-2-ylaniline is sourced from PubChem (CID 159191806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).